Compound Q&A

How is 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6) typically synthesized?

Answer

3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide
3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide can be synthesized through a multi-step reaction involving thiophene sulfonamide formation followed by bromoacetylation. Commonly, thiophene sulfonamide is prepared by reacting thiophene with sodium hydrosulfite in an aqueous medium, followed by acetylation with acetyl chloride in the presence of a base like pyridine. The resulting acetylated intermediate is then brominated using bromine in the presence of a Lewis acid like aluminum bromide to introduce the bromoacetyl group.

About

English Name 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide
Molecular Formula C6H5BrClNO3S2
Molecular Weight 318.6 g/mol
SMILES C1=C(SC(=C1C(=O)CBr)S(=O)(=O)N)Cl
InChIKey OZESFFKYLOCAOV-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6)?

3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide is a white to off-white crystalline solid with a mol...

Compound Q&A

What industries use 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6)?

3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6)?

When handling 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...