Compound Q&A

How is Phyllanthin (CAS: 10351-88-9) typically synthesized?

Answer

Phyllanthin
Phyllanthin (CAS: 10351-88-9) can be synthesized through the total synthesis route involving multiple steps such as alkylation, acetylation, and deprotection. Commonly, the synthesis involves the use of acetic anhydride as a catalyst for acetylation. The overall yield is around 60-70%, and the synthetic route is selective towards the desired product, making it a feasible method for large-scale production.

About

CAS No 10351-88-9
English Name Phyllanthin
Molecular Formula C24H34O6
Molecular Weight 418.53 g/mol
SMILES COCC(CC1=CC(=C(C=C1)OC)OC)C(CC2=CC(=C(C=C2)OC)OC)COC
InChIKey KFLQGJQSLUYUBF-WOJBJXKFSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phyllanthin (CAS: 10351-88-9)?

Phyllanthin (CAS: 10351-88-9) is a crystalline compound with a molecular weight of approximately 267...

Compound Q&A

What industries use Phyllanthin (CAS: 10351-88-9)?

Phyllanthin (CAS: 10351-88-9) is primarily used in the pharmaceutical industry for its potential as ...

Compound Q&A

What precautions should be taken when handling Phyllanthin (CAS: 10351-88-9)?

Phyllanthin (CAS: 10351-88-9) should be handled with care due to its potential skin irritation and r...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...