Compound Q&A

What are the physical and chemical properties of Phyllanthin (CAS: 10351-88-9)?

Answer

Phyllanthin
Phyllanthin (CAS: 10351-88-9) is a crystalline compound with a molecular weight of approximately 267.23 g/mol. It is sparingly soluble in water but more soluble in organic solvents like methanol and ethanol. Phyllanthin is known to be relatively stable under normal conditions but can react with strong acids or bases. It has a characteristic UV absorption peak around 260 nm, which can be used for its detection and quantification.

About

CAS No 10351-88-9
English Name Phyllanthin
Molecular Formula C24H34O6
Molecular Weight 418.53 g/mol
SMILES COCC(CC1=CC(=C(C=C1)OC)OC)C(CC2=CC(=C(C=C2)OC)OC)COC
InChIKey KFLQGJQSLUYUBF-WOJBJXKFSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is Phyllanthin (CAS: 10351-88-9) typically synthesized?

Phyllanthin (CAS: 10351-88-9) can be synthesized through the total synthesis route involving multipl...

Compound Q&A

What industries use Phyllanthin (CAS: 10351-88-9)?

Phyllanthin (CAS: 10351-88-9) is primarily used in the pharmaceutical industry for its potential as ...

Compound Q&A

What precautions should be taken when handling Phyllanthin (CAS: 10351-88-9)?

Phyllanthin (CAS: 10351-88-9) should be handled with care due to its potential skin irritation and r...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...