Compound Q&A

What industries use Isoquinolin-6-ylboronic acid (CAS: 899438-92-7)?

Answer

Isoquinolin-6-ylboronic acid
Isoquinolin-6-ylboronic acid is primarily used in the pharmaceutical industry for developing new drugs and intermediates. It also finds applications in the synthesis of polymers and sensors due to its unique chemical properties. Additionally, it is utilized in the synthesis of semiconductors and other advanced materials, contributing to the development of new technologies.

About

English Name Isoquinolin-6-ylboronic acid
Molecular Formula C9H8BNO2
Molecular Weight 172.98 g/mol
SMILES B(C1=CC2=C(C=C1)C=NC=C2)(O)O
InChIKey OBUOMTRFSCUDKS-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isoquinolin-6-ylboronic acid (CAS: 899438-92-7)?

Isoquinolin-6-ylboronic acid is a crystalline solid with a molecular weight of approximately 240.3 g...

Compound Q&A

How is Isoquinolin-6-ylboronic acid (CAS: 899438-92-7) typically synthesized?

Isoquinolin-6-ylboronic acid is typically synthesized through the reaction of 6-bromoisoquinoline wi...

Compound Q&A

What precautions should be taken when handling Isoquinolin-6-ylboronic acid (CAS: 899438-92-7)?

When handling Isoquinolin-6-ylboronic acid, it is important to wear protective gloves and goggles to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...