Compound Q&A

How is Isoquinolin-6-ylboronic acid (CAS: 899438-92-7) typically synthesized?

Answer

Isoquinolin-6-ylboronic acid
Isoquinolin-6-ylboronic acid is typically synthesized through the reaction of 6-bromoisoquinoline with borane-dimethyl sulfide complex followed by catalytic hydrogenation. This method provides good yield and selectivity, often using Pd/C as the catalyst. Other routes include direct condensation of appropriate precursors, which can be optimized for specific applications and reactivity profiles.

About

English Name Isoquinolin-6-ylboronic acid
Molecular Formula C9H8BNO2
Molecular Weight 172.98 g/mol
SMILES B(C1=CC2=C(C=C1)C=NC=C2)(O)O
InChIKey OBUOMTRFSCUDKS-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isoquinolin-6-ylboronic acid (CAS: 899438-92-7)?

Isoquinolin-6-ylboronic acid is a crystalline solid with a molecular weight of approximately 240.3 g...

Compound Q&A

What industries use Isoquinolin-6-ylboronic acid (CAS: 899438-92-7)?

Isoquinolin-6-ylboronic acid is primarily used in the pharmaceutical industry for developing new dru...

Compound Q&A

What precautions should be taken when handling Isoquinolin-6-ylboronic acid (CAS: 899438-92-7)?

When handling Isoquinolin-6-ylboronic acid, it is important to wear protective gloves and goggles to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...