Compound Q&A

What are the physical and chemical properties of Isoquinolin-6-ylboronic acid (CAS: 899438-92-7)?

Answer

Isoquinolin-6-ylboronic acid
Isoquinolin-6-ylboronic acid is a crystalline solid with a molecular weight of approximately 240.3 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and methanol. Chemically, it is less reactive compared to other boronic acids, making it suitable for specific synthetic transformations. It is often used as a building block in organic synthesis due to its stability and functional group reactivity.

About

English Name Isoquinolin-6-ylboronic acid
Molecular Formula C9H8BNO2
Molecular Weight 172.98 g/mol
SMILES B(C1=CC2=C(C=C1)C=NC=C2)(O)O
InChIKey OBUOMTRFSCUDKS-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is Isoquinolin-6-ylboronic acid (CAS: 899438-92-7) typically synthesized?

Isoquinolin-6-ylboronic acid is typically synthesized through the reaction of 6-bromoisoquinoline wi...

Compound Q&A

What industries use Isoquinolin-6-ylboronic acid (CAS: 899438-92-7)?

Isoquinolin-6-ylboronic acid is primarily used in the pharmaceutical industry for developing new dru...

Compound Q&A

What precautions should be taken when handling Isoquinolin-6-ylboronic acid (CAS: 899438-92-7)?

When handling Isoquinolin-6-ylboronic acid, it is important to wear protective gloves and goggles to...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...