Compound Q&A

What precautions should be taken when handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4)?

Answer

5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one
Handle the compound in a well-ventilated area or fume hood due to its potential to produce volatile compounds. Wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Store in a cool, dry place away from direct sunlight. In case of spill, immediately clean up using appropriate absorbent materials and refer to the safety data sheet (SDS) for further guidance.

About

CAS No 72357-31-4
English Name 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one
Molecular Formula C20H18O5
Molecular Weight 338.36 g/mol
SMILES CC(=CCc1c(cc(c2c1oc(cc2=O)c3ccc(cc3)O)O)O)C
InChIKey MEHHCBRCXIDGKZ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4)?

The compound is a crystalline solid with a molecular weight of approximately 343.33 g/mol. It is sli...

Compound Q&A

How is 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4) typically synthesized?

This compound can be synthesized via a condensation reaction between a substituted chromone and an a...

Compound Q&A

What industries use 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4)?

This compound finds application in the pharmaceutical industry for its potential as a drug precursor...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...