Compound Q&A

How is 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4) typically synthesized?

Answer

5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one
This compound can be synthesized via a condensation reaction between a substituted chromone and an aldehyde, followed by reduction and ring closure. Common catalysts include palladium on carbon, and the reaction typically yields a mixture of diastereomers. Optimal conditions include use of a mild reducing agent and appropriate solvent to ensure high selectivity and yield.

About

CAS No 72357-31-4
English Name 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one
Molecular Formula C20H18O5
Molecular Weight 338.36 g/mol
SMILES CC(=CCc1c(cc(c2c1oc(cc2=O)c3ccc(cc3)O)O)O)C
InChIKey MEHHCBRCXIDGKZ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4)?

The compound is a crystalline solid with a molecular weight of approximately 343.33 g/mol. It is sli...

Compound Q&A

What industries use 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4)?

This compound finds application in the pharmaceutical industry for its potential as a drug precursor...

Compound Q&A

What precautions should be taken when handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4)?

Handle the compound in a well-ventilated area or fume hood due to its potential to produce volatile ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...