Compound Q&A

What are the physical and chemical properties of 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4)?

Answer

5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one
The compound is a crystalline solid with a molecular weight of approximately 343.33 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. Chemically, it is moderately reactive, particularly towards nucleophiles and electrophiles. It exhibits good stability under normal storage conditions but requires handling under an inert atmosphere to prevent degradation.

About

CAS No 72357-31-4
English Name 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one
Molecular Formula C20H18O5
Molecular Weight 338.36 g/mol
SMILES CC(=CCc1c(cc(c2c1oc(cc2=O)c3ccc(cc3)O)O)O)C
InChIKey MEHHCBRCXIDGKZ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4) typically synthesized?

This compound can be synthesized via a condensation reaction between a substituted chromone and an a...

Compound Q&A

What industries use 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4)?

This compound finds application in the pharmaceutical industry for its potential as a drug precursor...

Compound Q&A

What precautions should be taken when handling 5,7-Dihydroxy-2-(4-hydroxyphenyl)-8-(3-methyl-2-buten-1-yl)-4H-chromen-4-one (CAS: 72357-31-4)?

Handle the compound in a well-ventilated area or fume hood due to its potential to produce volatile ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...