Compound Q&A

What industries use Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7)?

Answer

Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It is also utilized in the polymer industry for modifying polymer properties and in the analytical sector for sensor applications. Its reactivity and functionality make it a valuable intermediate in chemical synthesis.

About

English Name Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
Molecular Formula C12H17ClN2O2
Molecular Weight 256.73 g/mol
SMILES C1CN(CC1N)C(=O)OCC2=CC=CC=C2.Cl
InChIKey QNQVBYGRFHOBNO-MERQFXBCSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7)?

Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) is a crystalline solid...

Compound Q&A

How is Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) typically synthesized?

Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) is synthesized through...

Compound Q&A

What precautions should be taken when handling Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7)?

When handling Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7), it is i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...