Compound Q&A

What are the physical and chemical properties of Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7)?

Answer

Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) is a crystalline solid with a molecular weight of approximately 269.9 g/mol. It has a pKa of about 1.8, indicating strong acidity. The compound is soluble in water and ethanol. It is mildly basic and can react with acids to form the corresponding salts. It is used in pharmaceutical and chemical synthesis due to its reactivity and functionality.

About

English Name Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
Molecular Formula C12H17ClN2O2
Molecular Weight 256.73 g/mol
SMILES C1CN(CC1N)C(=O)OCC2=CC=CC=C2.Cl
InChIKey QNQVBYGRFHOBNO-MERQFXBCSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) typically synthesized?

Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) is synthesized through...

Compound Q&A

What industries use Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7)?

Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) is primarily used in t...

Compound Q&A

What precautions should be taken when handling Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7)?

When handling Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7), it is i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...