Compound Q&A

How is Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) typically synthesized?

Answer

Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) is synthesized through the condensation of benzylamine with 1-pyrrolidinecarboxylic acid in the presence of a suitable base like triethylamine. The reaction is typically carried out in an aqueous medium, followed by the addition of hydrochloric acid to protonate the amine group, yielding the hydrochloride salt. This process ensures high yield and good purity.

About

English Name Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (1:1)
Molecular Formula C12H17ClN2O2
Molecular Weight 256.73 g/mol
SMILES C1CN(CC1N)C(=O)OCC2=CC=CC=C2.Cl
InChIKey QNQVBYGRFHOBNO-MERQFXBCSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7)?

Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) is a crystalline solid...

Compound Q&A

What industries use Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7)?

Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7) is primarily used in t...

Compound Q&A

What precautions should be taken when handling Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7)?

When handling Benzyl (3S)-3-amino-1-pyrrolidinecarboxylate hydrochloride (CAS: 550378-39-7), it is i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...