Compound Q&A

What precautions should be taken when handling Alvespimycin Hydrochloride (CAS: 467214-20-6)?

Answer

Alvespimycin Hydrochloride
When handling Alvespimycin Hydrochloride, it is crucial to follow standard safety procedures. Wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize exposure to the compound. Store at room temperature in a dry, cool place, away from direct sunlight and heat sources. In case of spills, immediately clean up using appropriate absorbent materials and consult the Material Safety Data Sheet (MSDS) for specific cleanup procedures. Always follow the guidelines outlined in the SDS for safe handling and disposal.

About

English Name Alvespimycin Hydrochloride
Molecular Formula C32H48N4O8
Molecular Weight 616.7560000000001 g/mol
SMILES CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCCN(C)C)C)OC)OC(=O)N)C)C)O)OC
InChIKey KUFRQPKVAWMTJO-LMZWQJSESA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alvespimycin Hydrochloride (CAS: 467214-20-6)?

Alvespimycin Hydrochloride is a white to off-white crystalline powder with a molecular weight of app...

Compound Q&A

How is Alvespimycin Hydrochloride (CAS: 467214-20-6) typically synthesized?

Alvespimycin Hydrochloride is typically synthesized through a multi-step process involving ring form...

Compound Q&A

What industries use Alvespimycin Hydrochloride (CAS: 467214-20-6)?

Alvespimycin Hydrochloride is primarily used in the pharmaceutical industry for its potential as an ...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...