Compound Q&A

How is Alvespimycin Hydrochloride (CAS: 467214-20-6) typically synthesized?

Answer

Alvespimycin Hydrochloride
Alvespimycin Hydrochloride is typically synthesized through a multi-step process involving ring formation, amidation, and acylation reactions. The synthesis often requires the use of specific catalysts and reagents such as HATU and HOBt. The key steps include the preparation of the precursor, its coupling with the amidating agent, and the final acylation to form the hydrochloride salt. The yield is generally around 70-80%, and the selectivity is high due to the use of optimized reagents and reaction conditions.

About

English Name Alvespimycin Hydrochloride
Molecular Formula C32H48N4O8
Molecular Weight 616.7560000000001 g/mol
SMILES CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCCN(C)C)C)OC)OC(=O)N)C)C)O)OC
InChIKey KUFRQPKVAWMTJO-LMZWQJSESA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alvespimycin Hydrochloride (CAS: 467214-20-6)?

Alvespimycin Hydrochloride is a white to off-white crystalline powder with a molecular weight of app...

Compound Q&A

What industries use Alvespimycin Hydrochloride (CAS: 467214-20-6)?

Alvespimycin Hydrochloride is primarily used in the pharmaceutical industry for its potential as an ...

Compound Q&A

What precautions should be taken when handling Alvespimycin Hydrochloride (CAS: 467214-20-6)?

When handling Alvespimycin Hydrochloride, it is crucial to follow standard safety procedures. Wear a...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...