Compound Q&A

What are the physical and chemical properties of Alvespimycin Hydrochloride (CAS: 467214-20-6)?

Answer

Alvespimycin Hydrochloride
Alvespimycin Hydrochloride is a white to off-white crystalline powder with a molecular weight of approximately 644.8 g/mol. It has a pKa of about 2.5 and a solubility of around 10 mg/mL in water. The compound is slightly acidic and prone to hydrolysis under basic conditions. It exhibits good solubility in organic solvents like ethanol and methanol but is poorly soluble in nonpolar solvents. It is not reactive under normal conditions but may undergo slow degradation when exposed to moisture.

About

English Name Alvespimycin Hydrochloride
Molecular Formula C32H48N4O8
Molecular Weight 616.7560000000001 g/mol
SMILES CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCCN(C)C)C)OC)OC(=O)N)C)C)O)OC
InChIKey KUFRQPKVAWMTJO-LMZWQJSESA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is Alvespimycin Hydrochloride (CAS: 467214-20-6) typically synthesized?

Alvespimycin Hydrochloride is typically synthesized through a multi-step process involving ring form...

Compound Q&A

What industries use Alvespimycin Hydrochloride (CAS: 467214-20-6)?

Alvespimycin Hydrochloride is primarily used in the pharmaceutical industry for its potential as an ...

Compound Q&A

What precautions should be taken when handling Alvespimycin Hydrochloride (CAS: 467214-20-6)?

When handling Alvespimycin Hydrochloride, it is crucial to follow standard safety procedures. Wear a...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...