Compound Q&A

What industries use Alvespimycin Hydrochloride (CAS: 467214-20-6)?

Answer

Alvespimycin Hydrochloride
Alvespimycin Hydrochloride is primarily used in the pharmaceutical industry for its potential as an antineoplastic agent. It has shown promise in clinical trials for the treatment of certain types of cancer, particularly in combination therapies. Additionally, due to its chemical structure, it may have applications in the development of new drug delivery systems and as a research tool in synthetic chemistry.

About

English Name Alvespimycin Hydrochloride
Molecular Formula C32H48N4O8
Molecular Weight 616.7560000000001 g/mol
SMILES CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCCN(C)C)C)OC)OC(=O)N)C)C)O)OC
InChIKey KUFRQPKVAWMTJO-LMZWQJSESA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alvespimycin Hydrochloride (CAS: 467214-20-6)?

Alvespimycin Hydrochloride is a white to off-white crystalline powder with a molecular weight of app...

Compound Q&A

How is Alvespimycin Hydrochloride (CAS: 467214-20-6) typically synthesized?

Alvespimycin Hydrochloride is typically synthesized through a multi-step process involving ring form...

Compound Q&A

What precautions should be taken when handling Alvespimycin Hydrochloride (CAS: 467214-20-6)?

When handling Alvespimycin Hydrochloride, it is crucial to follow standard safety procedures. Wear a...

Compound Q&A

Is 4-Benzyl-2,2-dimethylmorpholine (CAS: 84761-04-6) safe?

4-Benzyl-2,2-dimethylmorpholine is generally considered safe when handled under ...

84761-04-64-Benzyl-2,2-dimethy...
Compound Q&A

What is (5,6-Dimethoxy-3-pyridinyl)boronic acid (CAS: 1346526-61-1)?

(5,6-Dimethoxy-3-pyridinyl)boronic acid is a chemical compound with the molecula...

1346526-61-1(5,6-Dimethoxy-3-pyr...
Compound Q&A

How is 1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane (CAS: 67875-55-2) typically synthesized?

1,1,3,3-Tetramethyl-1,3-bis(2-methyl-2-propanyl)disiloxane is synthesized throug...

67875-55-21,1,3,3-Tetramethyl-...
Compound Q&A

What are the main uses of (2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid (CAS: 1018818-04-6)?

(2R,4S)-1-Boc-4-methylpyrrolidine-2-carboxylic acid is primarily used as a build...

1018818-04-6(2R,4S)-1-Boc-4-meth...