Compound Q&A

What precautions should be taken when handling 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3)?

Answer

2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone
When handling 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3), safety measures include wearing appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be used in a well-ventilated area or a fume hood to avoid inhalation. In case of a spill, neutralize the spill with an appropriate solvent and dispose of it according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed information on handling and emergency procedures.

About

CAS No 71526-07-3
English Name 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone
Molecular Formula C10H15Cl2NO2
Molecular Weight 252.14 g/mol
SMILES C1CCC2(CC1)N(CCO2)C(=O)C(Cl)Cl
InChIKey QWWHRELOCZEQNZ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3)?

2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3) is a solid with a crystalli...

Compound Q&A

How is 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3) typically synthesized?

2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3) is typically synthesized vi...

Compound Q&A

What industries use 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3)?

2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3) is primarily used in the ph...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...