Compound Q&A

What are the physical and chemical properties of 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3)?

Answer

2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone
2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3) is a solid with a crystalline form at room temperature. Its molecular weight is approximately 267.07 g/mol. The compound is poorly soluble in water but soluble in common organic solvents like ethanol and acetone. It is moderately reactive and can undergo nucleophilic substitution reactions. Chemically, it is stable under normal conditions but should be stored away from moisture and direct sunlight.

About

CAS No 71526-07-3
English Name 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone
Molecular Formula C10H15Cl2NO2
Molecular Weight 252.14099999999993 g/mol
SMILES C1CCC2(CC1)N(CCO2)C(=O)C(Cl)Cl
InChIKey QWWHRELOCZEQNZ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3) typically synthesized?

2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3) is typically synthesized vi...

Compound Q&A

What industries use 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3)?

2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3) is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3)?

When handling 2,2-Dichloro-1-(1-oxa-4-azaspiro[4.5]dec-4-yl)ethanone (CAS: 71526-07-3), safety measu...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...