Compound Q&A

How is Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0) typically synthesized?

Answer

Fmoc-Thr(Bzl)-OH
Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0) is typically synthesized through a multi-step process involving the protection of the Thr(Bzl) moiety with Fmoc (fluorenylmethoxycarbonyl) functional group. The synthesis involves the coupling of D-Thr(Bzl)-OH with Fmoc-Cl in the presence of a base like diisopropylethylamine (DIPEA) and a solvent like DMF. The yield and selectivity are high, and the reaction is carefully monitored to ensure optimal conditions.

About

English Name Fmoc-Thr(Bzl)-OH
Molecular Formula C26H25NO5
Molecular Weight 431.49 g/mol
SMILES CC(C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OCC4=CC=CC=C4
InChIKey UCDMMWCWPVCHLL-OSPHWJPCSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0)?

Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0) is a solid with a crystalline form. Its molecular weight is appr...

Compound Q&A

What industries use Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0)?

Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0) is widely used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0)?

When handling Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0), it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...