Compound Q&A

What are the physical and chemical properties of Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0)?

Answer

Fmoc-Thr(Bzl)-OH
Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0) is a solid with a crystalline form. Its molecular weight is approximately 420.47 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and DMF. Chemically, it is reactive towards nucleophiles and can be used in peptide coupling reactions. It is also amphoteric, meaning it can act as both an acid and a base under certain conditions.

About

English Name Fmoc-Thr(Bzl)-OH
Molecular Formula C26H25NO5
Molecular Weight 431.49 g/mol
SMILES CC(C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OCC4=CC=CC=C4
InChIKey UCDMMWCWPVCHLL-OSPHWJPCSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0) typically synthesized?

Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0) is typically synthesized through a multi-step process involving ...

Compound Q&A

What industries use Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0)?

Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0) is widely used in the pharmaceutical industry for the synthesis ...

Compound Q&A

What precautions should be taken when handling Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0)?

When handling Fmoc-Thr(Bzl)-OH (CAS: 117872-75-0), it is essential to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...