Compound Q&A

What industries use 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid (CAS: 39091-01-5)?

Answer

4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid
4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid is primarily used in the pharmaceutical industry as an intermediate for drug synthesis. It is also found in polymer and sensor applications, where its unique chemical properties make it suitable for these specialized industries.

About

CAS No 39091-01-5
English Name 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid
Molecular Formula C10H8N2O2S
Molecular Weight 220.25 g/mol
SMILES CC1=C(SC(=N1)C2=CN=CC=C2)C(=O)O
InChIKey CJLQNROYBZEUGH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid (CAS: 39091-01-5)?

4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid has a crystalline form and a molecular weigh...

Compound Q&A

How is 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid (CAS: 39091-01-5) typically synthesized?

This compound is usually synthesized by the condensation of 4-methyl-2-(3-pyridinyl)-1,3-thiazole wi...

Compound Q&A

What precautions should be taken when handling 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid (CAS: 39091-01-5)?

When handling 4-Methyl-2-(3-pyridinyl)-1,3-thiazole-5-carboxylic acid, safety goggles and gloves sho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...