Compound Q&A

How is 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0) typically synthesized?

Answer

4-Amino-3-(trifluoromethyl)benzoic acid
4-Amino-3-(trifluoromethyl)benzoic acid is typically synthesized through a multi-step process starting from benzoic acid. The key steps include trifluoromethylation of benzoic acid followed by reduction to form the amino group. The synthesis requires mild conditions and can be catalyzed by various reagents to achieve high selectivity and yield.

About

CAS No 400-76-0
English Name 4-Amino-3-(trifluoromethyl)benzoic acid
Molecular Formula C8H6F3NO2
Molecular Weight 205.14 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)C(F)(F)F)N
InChIKey NPPPORJZPNJXNQ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0)?

4-Amino-3-(trifluoromethyl)benzoic acid is a white crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0)?

4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0) is used in the pharmaceutical industry for s...

Compound Q&A

What precautions should be taken when handling 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0)?

When handling 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0), it is important to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...