Compound Q&A

What are the physical and chemical properties of 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0)?

Answer

4-Amino-3-(trifluoromethyl)benzoic acid
4-Amino-3-(trifluoromethyl)benzoic acid is a white crystalline solid with a molecular weight of approximately 263.08 g/mol. It has low water solubility (less than 0.1 g/L at 20°C) but is soluble in organic solvents like DMSO and acetonitrile. This compound is known for its low reactivity and stability under normal conditions.

About

CAS No 400-76-0
English Name 4-Amino-3-(trifluoromethyl)benzoic acid
Molecular Formula C8H6F3NO2
Molecular Weight 205.14 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)C(F)(F)F)N
InChIKey NPPPORJZPNJXNQ-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0) typically synthesized?

4-Amino-3-(trifluoromethyl)benzoic acid is typically synthesized through a multi-step process starti...

Compound Q&A

What industries use 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0)?

4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0) is used in the pharmaceutical industry for s...

Compound Q&A

What precautions should be taken when handling 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0)?

When handling 4-Amino-3-(trifluoromethyl)benzoic acid (CAS: 400-76-0), it is important to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...