Compound Q&A

What industries use 2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (CAS: 51537-21-4)?

Answer

2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (1:1)
This compound is primarily used in the pharmaceutical industry for its potential as a chiral intermediate in the synthesis of drugs. It can also be utilized in the chemical industry as a reagent in various organic synthesis reactions. Additionally, it has applications in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 51537-21-4
English Name 2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (1:1)
Molecular Formula C11H24ClNO3
Molecular Weight 253.77 g/mol
SMILES CC(C)(C)OCC(C(=O)OC(C)(C)C)N.Cl
InChIKey RDWZQVGVBTYCBD-QRPNPIFTSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (CAS: 51537-21-4)?

2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride is a white crystalline solid wi...

Compound Q&A

How is 2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (CAS: 51537-21-4) typically synthesized?

This compound can be synthesized through a multi-step process involving the condensation of 2-methyl...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (CAS: 51537-21-4)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...