Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (CAS: 51537-21-4)?

Answer

2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (1:1)
2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride is a white crystalline solid with a molecular weight of approximately 444.1 g/mol. It has a hydrophobic nature and good solubility in organic solvents such as ethanol and acetone. This compound is relatively stable under normal conditions but can react with strong bases. It is not flammable and does not pose a significant risk in handling under standard laboratory conditions.

About

CAS No 51537-21-4
English Name 2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (1:1)
Molecular Formula C11H24ClNO3
Molecular Weight 253.77 g/mol
SMILES CC(C)(C)OCC(C(=O)OC(C)(C)C)N.Cl
InChIKey RDWZQVGVBTYCBD-QRPNPIFTSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (CAS: 51537-21-4) typically synthesized?

This compound can be synthesized through a multi-step process involving the condensation of 2-methyl...

Compound Q&A

What industries use 2-Methyl-2-propanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (CAS: 51537-21-4)?

This compound is primarily used in the pharmaceutical industry for its potential as a chiral interme...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl O-(2-methyl-2-propanyl)-L-serinate hydrochloride (CAS: 51537-21-4)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...