Compound Q&A

What industries use (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (CAS: 25519-82-8)?

Answer

(4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (1:1)
(4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride finds applications in the pharmaceutical industry, where it serves as a precursor for the synthesis of certain drugs. It is also used in the polymer industry for its potential as a stabilizer or modifier. Additionally, it has some applications in sensors and as a component in the development of certain semiconductor materials.

About

CAS No 25519-82-8
English Name (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (1:1)
Molecular Formula C13H18ClNO2
Molecular Weight 255.74 g/mol
SMILES COC1=CC=C(C=C1)C(=O)C2CCNCC2.Cl
InChIKey BBDTWYQCXXFKDH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (CAS: 25519-82-8)?

(4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride is a crystalline compound with a molecular w...

Compound Q&A

How is (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (CAS: 25519-82-8) typically synthesized?

(4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride is typically synthesized through a multi-ste...

Compound Q&A

What precautions should be taken when handling (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (CAS: 25519-82-8)?

When handling (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...