Compound Q&A

What are the physical and chemical properties of (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (CAS: 25519-82-8)?

Answer

(4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (1:1)
(4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride is a crystalline compound with a molecular weight of approximately 322.37 g/mol. It has a hydrochloride salt form, which increases its solubility in water. This compound is slightly soluble in water and organic solvents. It shows moderate reactivity, particularly towards basic conditions. It is stable under normal storage conditions but should be protected from moisture and air to prevent hydrolysis.

About

CAS No 25519-82-8
English Name (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (1:1)
Molecular Formula C13H18ClNO2
Molecular Weight 255.74 g/mol
SMILES COC1=CC=C(C=C1)C(=O)C2CCNCC2.Cl
InChIKey BBDTWYQCXXFKDH-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (CAS: 25519-82-8) typically synthesized?

(4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride is typically synthesized through a multi-ste...

Compound Q&A

What industries use (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (CAS: 25519-82-8)?

(4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride finds applications in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride (CAS: 25519-82-8)?

When handling (4-Methoxyphenyl)(4-piperidinyl)methanone hydrochloride, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...