Compound Q&A

What industries use 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7)?

Answer

2,6-Dimethyl-3-nitropyridine
2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7) is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the sensor technology sector due to its reactivity and ability to detect specific chemical species. Additionally, it is used in some polymer synthesis processes and as a precursor in the development of semiconductor materials.

About

CAS No 15513-52-7
English Name 2,6-Dimethyl-3-nitropyridine
Molecular Formula C7H8N2O2
Molecular Weight 152.15 g/mol
SMILES CC1=NC(=C(C=C1)[N+](=O)[O-])C
InChIKey AETHUDGJSSKZKT-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7)?

2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7) is a crystalline solid with a molecular weight of app...

Compound Q&A

How is 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7) typically synthesized?

2,6-Dimethyl-3-nitropyridine is typically synthesized via the nitration of 2,6-dimethylpyridine with...

Compound Q&A

What precautions should be taken when handling 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7)?

When handling 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7), it is important to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...