Compound Q&A

How is 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7) typically synthesized?

Answer

2,6-Dimethyl-3-nitropyridine
2,6-Dimethyl-3-nitropyridine is typically synthesized via the nitration of 2,6-dimethylpyridine with nitric acid in the presence of a suitable acid catalyst like concentrated sulfuric acid. The reaction is carried out under reflux conditions, and the product is isolated by recrystallization from an appropriate solvent.

About

CAS No 15513-52-7
English Name 2,6-Dimethyl-3-nitropyridine
Molecular Formula C7H8N2O2
Molecular Weight 152.15 g/mol
SMILES CC1=NC(=C(C=C1)[N+](=O)[O-])C
InChIKey AETHUDGJSSKZKT-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7)?

2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7) is a crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7)?

2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7) is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7)?

When handling 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7), it is important to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...