Compound Q&A

What are the physical and chemical properties of 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7)?

Answer

2,6-Dimethyl-3-nitropyridine
2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7) is a crystalline solid with a molecular weight of approximately 181.14 g/mol. It is poorly soluble in water but soluble in organic solvents such as methanol and ethanol. Chemically, it is relatively reactive, particularly with reducing agents and bases. It can undergo substitution reactions and is prone to oxidative degradation.

About

CAS No 15513-52-7
English Name 2,6-Dimethyl-3-nitropyridine
Molecular Formula C7H8N2O2
Molecular Weight 152.15 g/mol
SMILES CC1=NC(=C(C=C1)[N+](=O)[O-])C
InChIKey AETHUDGJSSKZKT-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7) typically synthesized?

2,6-Dimethyl-3-nitropyridine is typically synthesized via the nitration of 2,6-dimethylpyridine with...

Compound Q&A

What industries use 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7)?

2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7) is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7)?

When handling 2,6-Dimethyl-3-nitropyridine (CAS: 15513-52-7), it is important to use personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...