Compound Q&A

What industries use 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9)?

Answer

2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate
2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) is used in the pharmaceutical industry for the synthesis of various medicinal compounds. It is also utilized in the polymer industry for modifying polymer properties and in the sensor industry for its chemical sensing capabilities. Additionally, it can be found in the semiconductor industry for specific applications.

About

English Name 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate
Molecular Formula C19H23NO2
Molecular Weight 297.4 g/mol
SMILES CC(C)Cc1ccc(cc1)C(C)C(=O)OCc2ccccn2
InChIKey ACEWLPOYLGNNHV-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9)?

2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) is a white crystalline solid wit...

Compound Q&A

How is 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) typically synthesized?

2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) is typically synthesized via est...

Compound Q&A

What precautions should be taken when handling 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9)?

When handling 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9), it is crucial to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...