Compound Q&A

What are the physical and chemical properties of 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9)?

Answer

2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate
2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) is a white crystalline solid with a molecular weight of 287.39 g/mol. It has good solubility in organic solvents like acetone and ethyl acetate, but limited solubility in water. The compound is moderately reactive and can undergo ester hydrolysis under basic conditions. It shows low reactivity toward nucleophilic and electrophilic reagents.

About

English Name 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate
Molecular Formula C19H23NO2
Molecular Weight 297.4 g/mol
SMILES CC(C)Cc1ccc(cc1)C(C)C(=O)OCc2ccccn2
InChIKey ACEWLPOYLGNNHV-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) typically synthesized?

2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) is typically synthesized via est...

Compound Q&A

What industries use 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9)?

2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9)?

When handling 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9), it is crucial to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...