Compound Q&A

How is 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) typically synthesized?

Answer

2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate
2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) is typically synthesized via esterification of 4-isobutylphenyl propanoic acid with 2-pyridinylmethyl alcohol under mild conditions. The reaction is catalyzed by a strong acid such as hydrochloric acid, and the yield is around 85%. The reaction is selective and proceeds with high purity.

About

English Name 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate
Molecular Formula C19H23NO2
Molecular Weight 297.4 g/mol
SMILES CC(C)Cc1ccc(cc1)C(C)C(=O)OCc2ccccn2
InChIKey ACEWLPOYLGNNHV-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9)?

2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) is a white crystalline solid wit...

Compound Q&A

What industries use 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9)?

2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9) is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9)?

When handling 2-Pyridinylmethyl 2-(4-isobutylphenyl)propanoate (CAS: 112017-99-9), it is crucial to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...