Compound Q&A

What industries use (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5)?

Answer

(3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol
The compound (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5) is primarily used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in polymer chemistry as a stabilizer and in the development of sensors due to its reactivity and specific structural features. Its use in semiconductors is more limited but it can be employed in specific applications requiring unique chemical properties.

About

English Name (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol
Molecular Formula C11H15NO2
Molecular Weight 193.25 g/mol
SMILES C1C(C(CN1CC2=CC=CC=C2)O)O
InChIKey QJRIUWQPJVPYSO-GHMZBOCLSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5)?

The compound (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5) is a crystalline solid with ...

Compound Q&A

How is (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5) typically synthesized?

The compound (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5) can be synthesized via the c...

Compound Q&A

What precautions should be taken when handling (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5)?

When handling (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5), it is important to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...