Compound Q&A

What are the physical and chemical properties of (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5)?

Answer

(3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol
The compound (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5) is a crystalline solid with a molecular weight of approximately 230.27 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound is known for its reactivity in nucleophilic substitution reactions and is susceptible to hydrolysis under basic conditions. Its physical properties include a melting point around 135-137°C.

About

English Name (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol
Molecular Formula C11H15NO2
Molecular Weight 193.25 g/mol
SMILES C1C(C(CN1CC2=CC=CC=C2)O)O
InChIKey QJRIUWQPJVPYSO-GHMZBOCLSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5) typically synthesized?

The compound (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5) can be synthesized via the c...

Compound Q&A

What industries use (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5)?

The compound (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5) is primarily used in the pha...

Compound Q&A

What precautions should be taken when handling (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5)?

When handling (3R,4R)-(-)-1-Benzyl-3,4-pyrrolidindiol (CAS: 163439-82-5), it is important to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...