Compound Q&A

What precautions should be taken when handling 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6)?

Answer

2-Hydroxy-N,N,N-trimethylethanaminium salicylate
When handling 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. This compound is reactive, so it should be stored in a cool, dry place away from strong acids and bases. In case of a spill, the area should be ventilated and the spill cleaned up using appropriate absorbent materials. Always refer to the safety data sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 2016-36-6
English Name 2-Hydroxy-N,N,N-trimethylethanaminium salicylate
Molecular Formula C12H19NO4
Molecular Weight 241.28 g/mol
SMILES C[N+](C)(C)CCO.Oc1ccccc1C(=O)[O-]
InChIKey UDKCHVLMFQVBAA-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6)?

2-Hydroxy-N,N,N-trimethylethanaminium salicylate is a white crystalline compound with a molecular we...

Compound Q&A

How is 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6) typically synthesized?

2-Hydroxy-N,N,N-trimethylethanaminium salicylate is typically synthesized by reacting salicylic acid...

Compound Q&A

What industries use 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6)?

2-Hydroxy-N,N,N-trimethylethanaminium salicylate is utilized in various industries due to its unique...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...