Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6)?

Answer

2-Hydroxy-N,N,N-trimethylethanaminium salicylate
2-Hydroxy-N,N,N-trimethylethanaminium salicylate is a white crystalline compound with a molecular weight of approximately 302.34 g/mol. It is slightly soluble in water and has a pKa of around 2.5. This compound exhibits basic properties due to the trimethylammonium group and acidic properties from the salicylate group, making it amphoteric. It is reactive towards strong acids and bases, and its solubility increases slightly with temperature.

About

CAS No 2016-36-6
English Name 2-Hydroxy-N,N,N-trimethylethanaminium salicylate
Molecular Formula C12H19NO4
Molecular Weight 241.28 g/mol
SMILES C[N+](C)(C)CCO.Oc1ccccc1C(=O)[O-]
InChIKey UDKCHVLMFQVBAA-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6) typically synthesized?

2-Hydroxy-N,N,N-trimethylethanaminium salicylate is typically synthesized by reacting salicylic acid...

Compound Q&A

What industries use 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6)?

2-Hydroxy-N,N,N-trimethylethanaminium salicylate is utilized in various industries due to its unique...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6)?

When handling 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...