Compound Q&A

How is 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6) typically synthesized?

Answer

2-Hydroxy-N,N,N-trimethylethanaminium salicylate
2-Hydroxy-N,N,N-trimethylethanaminium salicylate is typically synthesized by reacting salicylic acid with trimethylamine in the presence of a suitable catalyst such as hydrochloric acid. The reaction involves the formation of a salt between the salicylate anion and the trimethylammonium cation, resulting in a high yield of the target compound. The process is optimized for purity and yield, often requiring careful control of reaction conditions such as temperature and pH.

About

CAS No 2016-36-6
English Name 2-Hydroxy-N,N,N-trimethylethanaminium salicylate
Molecular Formula C12H19NO4
Molecular Weight 241.28 g/mol
SMILES C[N+](C)(C)CCO.Oc1ccccc1C(=O)[O-]
InChIKey UDKCHVLMFQVBAA-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6)?

2-Hydroxy-N,N,N-trimethylethanaminium salicylate is a white crystalline compound with a molecular we...

Compound Q&A

What industries use 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6)?

2-Hydroxy-N,N,N-trimethylethanaminium salicylate is utilized in various industries due to its unique...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6)?

When handling 2-Hydroxy-N,N,N-trimethylethanaminium salicylate (CAS: 2016-36-6), it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...