Compound Q&A

What precautions should be taken when handling (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0)?

Answer

(5-Acetyl-2-fluorophenyl)boronic acid
When handling (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a fume hood to minimize inhalation risk. Spills should be handled with care using appropriate absorbent materials, and the area should be ventilated. Always consult the Safety Data Sheet (SDS) for specific handling and emergency procedures.

About

English Name (5-Acetyl-2-fluorophenyl)boronic acid
Molecular Formula C8H8BFO3
Molecular Weight 181.96 g/mol
SMILES B(C1=C(C=CC(=C1)C(=O)C)F)(O)O
InChIKey FQVNUEBNRAIKBR-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0)?

(5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) is a crystalline solid with a molecular wei...

Compound Q&A

How is (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) typically synthesized?

(5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) can be synthesized via a multistep process ...

Compound Q&A

What industries use (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0)?

(5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) is primarily used in the pharmaceutical and...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...