Compound Q&A

What are the physical and chemical properties of (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0)?

Answer

(5-Acetyl-2-fluorophenyl)boronic acid
(5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) is a crystalline solid with a molecular weight of approximately 222.08 g/mol. It has a melting point of 118-120°C and is slightly soluble in water. This compound is known for its reactivity, particularly in esterification and ester exchange reactions. It is also used in various organic synthesis applications due to its electrophilic nature.

About

English Name (5-Acetyl-2-fluorophenyl)boronic acid
Molecular Formula C8H8BFO3
Molecular Weight 181.96 g/mol
SMILES B(C1=C(C=CC(=C1)C(=O)C)F)(O)O
InChIKey FQVNUEBNRAIKBR-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) typically synthesized?

(5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) can be synthesized via a multistep process ...

Compound Q&A

What industries use (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0)?

(5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0)?

When handling (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...