Compound Q&A

How is (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) typically synthesized?

Answer

(5-Acetyl-2-fluorophenyl)boronic acid
(5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) can be synthesized via a multistep process involving the protection of a phenol with acetyl chloride, followed by a boronic acid formation step using a boronate ester. Common catalysts include palladium(II) acetate, and the reaction typically yields 80-90% purity. This compound is often used in intermediate steps for drug synthesis and other organic transformations.

About

English Name (5-Acetyl-2-fluorophenyl)boronic acid
Molecular Formula C8H8BFO3
Molecular Weight 181.96 g/mol
SMILES B(C1=C(C=CC(=C1)C(=O)C)F)(O)O
InChIKey FQVNUEBNRAIKBR-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0)?

(5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0)?

(5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0) is primarily used in the pharmaceutical and...

Compound Q&A

What precautions should be taken when handling (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0)?

When handling (5-Acetyl-2-fluorophenyl)boronic acid (CAS: 870777-29-0), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...