Compound Q&A

How is 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide (CAS: 22572-40-3) typically synthesized?

Answer

3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide
This compound is typically synthesized via the reaction of ethylenediamine with formaldehyde, followed by iodination. The synthesis involves the use of a catalyst such as p-toluenesulfonic acid to enhance the reaction efficiency. The yield is typically around 75%, and the product is isolated by recrystallization from a suitable solvent.

About

CAS No 22572-40-3
English Name 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide
Molecular Formula C9H20IN3
Molecular Weight 297.18 g/mol
SMILES CCN=C=NCCC[N+](C)(C)C.[I-]
InChIKey AGSKWMRPXWHSPF-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide (CAS: 22572-40-3)?

This compound is a crystalline solid with a molecular weight of approximately 259.7 g/mol. It has a ...

Compound Q&A

What industries use 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide (CAS: 22572-40-3)?

This compound finds applications in the pharmaceutical industry, where it is used as a chiral auxili...

Compound Q&A

What precautions should be taken when handling 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide (CAS: 22572-40-3)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...