Compound Q&A

What are the physical and chemical properties of 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide (CAS: 22572-40-3)?

Answer

3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide
This compound is a crystalline solid with a molecular weight of approximately 259.7 g/mol. It has a high solubility in organic solvents like acetonitrile but is insoluble in water. Chemically, it is moderately reactive, particularly with nucleophiles. It is stable under normal conditions but should be stored in a dry environment to prevent hydrolysis.

About

CAS No 22572-40-3
English Name 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide
Molecular Formula C9H20IN3
Molecular Weight 297.18 g/mol
SMILES CCN=C=NCCC[N+](C)(C)C.[I-]
InChIKey AGSKWMRPXWHSPF-UHFFFAOYSA-M
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide (CAS: 22572-40-3) typically synthesized?

This compound is typically synthesized via the reaction of ethylenediamine with formaldehyde, follow...

Compound Q&A

What industries use 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide (CAS: 22572-40-3)?

This compound finds applications in the pharmaceutical industry, where it is used as a chiral auxili...

Compound Q&A

What precautions should be taken when handling 3-{[(Ethylimino)methylene]amino}-N,N,N-trimethyl-1-propanaminium iodide (CAS: 22572-40-3)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...