Compound Q&A

How is 2-Fluoro-4-methyl-3-nitropyridine (CAS: 19346-43-1) typically synthesized?

Answer

2-Fluoro-4-methyl-3-nitropyridine
2-Fluoro-4-methyl-3-nitropyridine is synthesized through a series of reactions including nitration of 4-methyl-3-pyridine carboxylic acid, followed by fluorination. Common catalysts include sulfuric acid for nitration and hydrogen fluoride for fluorination. The yield is around 70-80%.

About

CAS No 19346-43-1
English Name 2-Fluoro-4-methyl-3-nitropyridine
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES CC1=C(C(=NC=C1)F)[N+](=O)[O-]
InChIKey AUHFWLUBEJKXLN-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-methyl-3-nitropyridine (CAS: 19346-43-1)?

2-Fluoro-4-methyl-3-nitropyridine is a crystalline solid with a molecular weight of approximately 19...

Compound Q&A

What industries use 2-Fluoro-4-methyl-3-nitropyridine (CAS: 19346-43-1)?

2-Fluoro-4-methyl-3-nitropyridine is primarily used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-methyl-3-nitropyridine (CAS: 19346-43-1)?

When handling 2-Fluoro-4-methyl-3-nitropyridine, it is crucial to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...