Compound Q&A

What are the physical and chemical properties of 2-Fluoro-4-methyl-3-nitropyridine (CAS: 19346-43-1)?

Answer

2-Fluoro-4-methyl-3-nitropyridine
2-Fluoro-4-methyl-3-nitropyridine is a crystalline solid with a molecular weight of approximately 196.04 g/mol. It has limited water solubility and is soluble in organic solvents such as ethanol and acetone. It is known for its significant reactivity, particularly towards reduction and hydrolysis reactions.

About

CAS No 19346-43-1
English Name 2-Fluoro-4-methyl-3-nitropyridine
Molecular Formula C6H5FN2O2
Molecular Weight 156.11 g/mol
SMILES CC1=C(C(=NC=C1)F)[N+](=O)[O-]
InChIKey AUHFWLUBEJKXLN-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2-Fluoro-4-methyl-3-nitropyridine (CAS: 19346-43-1) typically synthesized?

2-Fluoro-4-methyl-3-nitropyridine is synthesized through a series of reactions including nitration o...

Compound Q&A

What industries use 2-Fluoro-4-methyl-3-nitropyridine (CAS: 19346-43-1)?

2-Fluoro-4-methyl-3-nitropyridine is primarily used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-4-methyl-3-nitropyridine (CAS: 19346-43-1)?

When handling 2-Fluoro-4-methyl-3-nitropyridine, it is crucial to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...