Compound Q&A

What industries use 5-Nitro-1-isoindolinone (CAS: 876343-38-3)?

Answer

5-Nitro-1-isoindolinone
5-Nitro-1-isoindolinone (CAS: 876343-38-3) finds applications in the pharmaceutical industry for the synthesis of various drugs. It is also used in the polymer industry as an intermediate for the production of certain polymers. Additionally, it is utilized in the development of sensors and as a component in the electronics industry for semiconductor applications.

About

English Name 5-Nitro-1-isoindolinone
Molecular Formula C8H6N2O3
Molecular Weight 178.14 g/mol
SMILES O=C1NCc2c1ccc(c2)[N+](=O)[O-]
InChIKey CZXUANYPXDFFOG-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-1-isoindolinone (CAS: 876343-38-3)?

5-Nitro-1-isoindolinone (CAS: 876343-38-3) is a crystalline compound with a molecular weight of appr...

Compound Q&A

How is 5-Nitro-1-isoindolinone (CAS: 876343-38-3) typically synthesized?

5-Nitro-1-isoindolinone (CAS: 876343-38-3) is typically synthesized via the nitration of 1-isoindoli...

Compound Q&A

What precautions should be taken when handling 5-Nitro-1-isoindolinone (CAS: 876343-38-3)?

When handling 5-Nitro-1-isoindolinone (CAS: 876343-38-3), it is crucial to wear personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...