Compound Q&A

What are the physical and chemical properties of 5-Nitro-1-isoindolinone (CAS: 876343-38-3)?

Answer

5-Nitro-1-isoindolinone
5-Nitro-1-isoindolinone (CAS: 876343-38-3) is a crystalline compound with a molecular weight of approximately 225.08 g/mol. It has a high solubility in organic solvents like acetonitrile and acetone but is poorly soluble in water. The compound is known for its chemical stability and is moderately reactive. It can undergo nitro reduction and other substitution reactions under specific conditions.

About

English Name 5-Nitro-1-isoindolinone
Molecular Formula C8H6N2O3
Molecular Weight 178.14 g/mol
SMILES O=C1NCc2c1ccc(c2)[N+](=O)[O-]
InChIKey CZXUANYPXDFFOG-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 5-Nitro-1-isoindolinone (CAS: 876343-38-3) typically synthesized?

5-Nitro-1-isoindolinone (CAS: 876343-38-3) is typically synthesized via the nitration of 1-isoindoli...

Compound Q&A

What industries use 5-Nitro-1-isoindolinone (CAS: 876343-38-3)?

5-Nitro-1-isoindolinone (CAS: 876343-38-3) finds applications in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 5-Nitro-1-isoindolinone (CAS: 876343-38-3)?

When handling 5-Nitro-1-isoindolinone (CAS: 876343-38-3), it is crucial to wear personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...