Compound Q&A

How is 5-Nitro-1-isoindolinone (CAS: 876343-38-3) typically synthesized?

Answer

5-Nitro-1-isoindolinone
5-Nitro-1-isoindolinone (CAS: 876343-38-3) is typically synthesized via the nitration of 1-isoindolinone using a nitric acid/sulfuric acid mixture. The reaction requires careful control of temperature and concentration to achieve high yield and selectivity. The process can also be catalyzed with iron(III) chloride to improve the reaction rate and selectivity.

About

English Name 5-Nitro-1-isoindolinone
Molecular Formula C8H6N2O3
Molecular Weight 178.14 g/mol
SMILES O=C1NCc2c1ccc(c2)[N+](=O)[O-]
InChIKey CZXUANYPXDFFOG-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Nitro-1-isoindolinone (CAS: 876343-38-3)?

5-Nitro-1-isoindolinone (CAS: 876343-38-3) is a crystalline compound with a molecular weight of appr...

Compound Q&A

What industries use 5-Nitro-1-isoindolinone (CAS: 876343-38-3)?

5-Nitro-1-isoindolinone (CAS: 876343-38-3) finds applications in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling 5-Nitro-1-isoindolinone (CAS: 876343-38-3)?

When handling 5-Nitro-1-isoindolinone (CAS: 876343-38-3), it is crucial to wear personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...