Compound Q&A

What are the physical and chemical properties of Fluo-3AM (CAS: 121714-22-5)?

Answer

Fluo-3AM
Fluo-3AM is a fluorescent calcium indicator dye with a molecular weight of approximately 556.37 g/mol. It exists in a crystalline form with excellent solubility in common organic solvents like DMSO and poor solubility in water. Fluo-3AM is relatively stable under physiological conditions but exhibits high reactivity in acidic environments. It is commonly used for calcium ion detection in biological systems due to its high specificity and sensitivity.

About

English Name Fluo-3AM
Molecular Formula C51H50Cl2N2O23
Molecular Weight 1129.8 g/mol
SMILES CC1=CC(=C(C=C1)N(CC(=O)OCOC(=O)C)CC(=O)OCOC(=O)C)OCCOC2=C(C=CC(=C2)C3=C4C=C(C(=O)C=C4OC5=CC(=C(C=C53)Cl)OCOC(=O)C)Cl)N(CC(=O)OCOC(=O)C)CC(=O)OCOC(=O)C
InChIKey PTPUOMXKXCCSEN-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is Fluo-3AM (CAS: 121714-22-5) typically synthesized?

Fluo-3AM is synthesized through a multi-step process involving the coupling of fluo-3 and succinimid...

Compound Q&A

What industries use Fluo-3AM (CAS: 121714-22-5)?

Fluo-3AM is widely used in the pharmaceutical, biotechnology, and bioresearch industries. It is esse...

Compound Q&A

What precautions should be taken when handling Fluo-3AM (CAS: 121714-22-5)?

When handling Fluo-3AM, it is crucial to wear appropriate personal protective equipment (PPE) includ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...