Compound Q&A

What industries use 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 749849-14-7)?

Answer

6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid
6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid is used in the pharmaceutical industry as a precursor for drug synthesis. It also finds applications in the development of sensors and as a building block in polymer chemistry. Additionally, it can be used in the synthesis of materials for semiconductors.

About

English Name 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=CC2=NC(=CN2C=C1Br)C(=O)O
InChIKey FQBFPVLZLNEQOE-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 749849-14-7)?

6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid is a solid at room temperature, with a molecular wei...

Compound Q&A

How is 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 749849-14-7) typically synthesized?

6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid is typically synthesized via a multistep process inv...

Compound Q&A

What precautions should be taken when handling 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS: 749849-14-7)?

When handling 6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid, it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...